C20H23NO4 — CID 39992148
1-[3-[3-(4-methoxyphenoxy)propoxy]phenyl]pyrrolidin-2-one (PubChem CID 39992148) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-[3-[3-(4-methoxyphenoxy)propoxy]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[3-(4-methoxyphenoxy)propoxy]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 39992148 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[3-[3-(4-methoxyphenoxy)propoxy]phenyl]pyrrolidin-2-one |
| SMILES | COc1ccc(OCCCOc2cccc(N3CCCC3=O)c2)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-23-17-8-10-18(11-9-17)24-13-4-14-25-19-6-2-5-16(15-19)21-12-3-7-20(21)22/h2,5-6,8-11,15H,3-4,7,12-14H2,1H3 |
| InChIKey | BLECEGSPKSCIDC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|