C21H20ClN3O3 — CID 3999491
[1-(2-chlorophenyl)-3-(3-methoxyphenyl)pyrazol-5-yl]-morpholin-4-ylmethanone (PubChem CID 3999491) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is [1-(2-chlorophenyl)-3-(3-methoxyphenyl)pyrazol-5-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(2-chlorophenyl)-3-(3-methoxyphenyl)pyrazol-5-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 3999491 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [1-(2-chlorophenyl)-3-(3-methoxyphenyl)pyrazol-5-yl]-morpholin-4-ylmethanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CCOCC3)n(-c3ccccc3Cl)n2)c1 |
| InChI | InChI=1S/C21H20ClN3O3/c1-27-16-6-4-5-15(13-16)18-14-20(21(26)24-9-11-28-12-10-24)25(23-18)19-8-3-2-7-17(19)22/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | OQAHXAGDXSBKJW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |