About (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate
(4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate (PubChem CID 39995225) has the molecular formula C18H16ClN3O2S
and a molecular weight of 373.87 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate.
Molecular Properties
| Compound Name | (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate |
| PubChem CID | 39995225 |
| Molecular Formula | C18H16ClN3O2S |
| Molecular Weight | 373.87 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CC(=O)Oc2ccc(Cl)cc2C)c1 |
| InChI | InChI=1S/C18H16ClN3O2S/c1-11-4-3-5-13(8-11)17-20-21-18(25)22(17)10-16(23)24-15-7-6-14(19)9-12(15)2/h3-9H,10H2,1-2H3,(H,21,25) |
| InChIKey | BDLIMFZHSVSJFT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate?
The IUPAC name of (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate (CID 39995225) is (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate.
What is the SMILES notation for (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate?
The canonical SMILES for (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate is Cc1cccc(-c2n[nH]c(=S)n2CC(=O)Oc2ccc(Cl)cc2C)c1.
What is the InChIKey of (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate?
The InChIKey is BDLIMFZHSVSJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3O2S/c1-11-4-3-5-13(8-11)17-20-21-18(25)22(17)10-16(23)24-15-7-6-14(19)9-12(15)2/h3-9H,10H2,1-2H3,(H,21,25).
What are the key properties of (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate?
(4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate has a molecular weight of 373.87 g/mol, XLogP of 4.48, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2-methylphenyl) 2-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]acetate is sourced from PubChem (CID 39995225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).