About 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide
3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide (PubChem CID 39997425) has the molecular formula C14H13N5OS
and a molecular weight of 299.36 g/mol. Its IUPAC name is 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide.
Molecular Properties
| Compound Name | 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide |
| PubChem CID | 39997425 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide |
| SMILES | O=C(CCc1cccs1)Nc1ccc(-n2cncn2)nc1 |
| InChI | InChI=1S/C14H13N5OS/c20-14(6-4-12-2-1-7-21-12)18-11-3-5-13(16-8-11)19-10-15-9-17-19/h1-3,5,7-10H,4,6H2,(H,18,20) |
| InChIKey | VZIDNQPCUOKGLF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide?
The IUPAC name of 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide (CID 39997425) is 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide.
What is the SMILES notation for 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide?
The canonical SMILES for 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide is O=C(CCc1cccs1)Nc1ccc(-n2cncn2)nc1.
What is the InChIKey of 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide?
The InChIKey is VZIDNQPCUOKGLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5OS/c20-14(6-4-12-2-1-7-21-12)18-11-3-5-13(16-8-11)19-10-15-9-17-19/h1-3,5,7-10H,4,6H2,(H,18,20).
What are the key properties of 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide?
3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide has a molecular weight of 299.36 g/mol, XLogP of 2.30, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-N-[6-(1,2,4-triazol-1-yl)-3-pyridinyl]propanamide is sourced from PubChem (CID 39997425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).