C13H20N4O2S2 — CID 39998462
N-[3-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]methanesulfonamide (PubChem CID 39998462) has the molecular formula C13H20N4O2S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[3-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]methanesulfonamide.
| Compound Name | N-[3-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 39998462 |
| Molecular Formula | C13H20N4O2S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[3-[(2,5,6-trimethylthieno[2,3-d]pyrimidin-4-yl)amino]propyl]methanesulfonamide |
| SMILES | Cc1nc(NCCCNS(C)(=O)=O)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C13H20N4O2S2/c1-8-9(2)20-13-11(8)12(16-10(3)17-13)14-6-5-7-15-21(4,18)19/h15H,5-7H2,1-4H3,(H,14,16,17) |
| InChIKey | VDUSOHZODQEVST-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|