C19H20N4O2S — CID 39999567
(3S)-2-phenyl-5-N-prop-2-enyl-5-N-(thiophen-2-ylmethyl)-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 39999567) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is (3S)-2-phenyl-5-N-prop-2-enyl-5-N-(thiophen-2-ylmethyl)-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | (3S)-2-phenyl-5-N-prop-2-enyl-5-N-(thiophen-2-ylmethyl)-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 39999567 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (3S)-2-phenyl-5-N-prop-2-enyl-5-N-(thiophen-2-ylmethyl)-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)C1=NN(c2ccccc2)[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C19H20N4O2S/c1-2-10-22(13-15-9-6-11-26-15)19(25)16-12-17(18(20)24)23(21-16)14-7-4-3-5-8-14/h2-9,11,17H,1,10,12-13H2,(H2,20,24)/t17-/m0/s1 |
| InChIKey | CRCUPIUPVBLIFR-KRWDZBQOSA-N |
| XLogP | 2.38 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|