About 4-butylphenol
4-butylphenol (PubChem CID 15420) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 4-butylphenol.
Molecular Properties
| Compound Name | 4-butylphenol |
| PubChem CID | 15420 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 4-butylphenol |
| SMILES | CCCCc1ccc(O)cc1 |
| InChI | InChI=1S/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| InChIKey | CYYZDBDROVLTJU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylphenol?
The IUPAC name of 4-butylphenol (CID 15420) is 4-butylphenol.
What is the SMILES notation for 4-butylphenol?
The canonical SMILES for 4-butylphenol is CCCCc1ccc(O)cc1.
What is the InChIKey of 4-butylphenol?
The InChIKey is CYYZDBDROVLTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3.
What are the key properties of 4-butylphenol?
4-butylphenol has a molecular weight of 150.22 g/mol, XLogP of 2.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylphenol is sourced from PubChem (CID 15420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).