About 4-iminooxolan-2-one
4-iminooxolan-2-one (PubChem CID 57115659) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is 4-iminooxolan-2-one.
Molecular Properties
| Compound Name | 4-iminooxolan-2-one |
| PubChem CID | 57115659 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 4-iminooxolan-2-one |
| SMILES | [H]/N=C1\COC(=O)C1 |
| InChI | InChI=1S/C4H5NO2/c5-3-1-4(6)7-2-3/h5H,1-2H2/b5-3- |
| InChIKey | KITSQDKRUBQKOD-HYXAFXHYSA-N |
| XLogP | -0.05 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-iminooxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iminooxolan-2-one?
The IUPAC name of 4-iminooxolan-2-one (CID 57115659) is 4-iminooxolan-2-one.
What is the SMILES notation for 4-iminooxolan-2-one?
The canonical SMILES for 4-iminooxolan-2-one is [H]/N=C1\COC(=O)C1.
What is the InChIKey of 4-iminooxolan-2-one?
The InChIKey is KITSQDKRUBQKOD-HYXAFXHYSA-N. The full InChI is InChI=1S/C4H5NO2/c5-3-1-4(6)7-2-3/h5H,1-2H2/b5-3-.
What are the key properties of 4-iminooxolan-2-one?
4-iminooxolan-2-one has a molecular weight of 99.09 g/mol, XLogP of -0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iminooxolan-2-one is sourced from PubChem (CID 57115659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).