About 4-phenoxyoxane
4-phenoxyoxane (PubChem CID 58483739) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-phenoxyoxane.
Molecular Properties
| Compound Name | 4-phenoxyoxane |
| PubChem CID | 58483739 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-phenoxyoxane |
| SMILES | c1ccc(OC2CCOCC2)cc1 |
| InChI | InChI=1S/C11H14O2/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h1-5,11H,6-9H2 |
| InChIKey | OYXGVZNVCITLOT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenoxyoxane?
The IUPAC name of 4-phenoxyoxane (CID 58483739) is 4-phenoxyoxane.
What is the SMILES notation for 4-phenoxyoxane?
The canonical SMILES for 4-phenoxyoxane is c1ccc(OC2CCOCC2)cc1.
What is the InChIKey of 4-phenoxyoxane?
The InChIKey is OYXGVZNVCITLOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h1-5,11H,6-9H2.
What are the key properties of 4-phenoxyoxane?
4-phenoxyoxane has a molecular weight of 178.23 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenoxyoxane is sourced from PubChem (CID 58483739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).