C12H7Cl3FN3 — CID 4000923
3,5,6-trichloro-N-[(3-fluorophenyl)methylideneamino]pyridin-2-amine (PubChem CID 4000923) has the molecular formula C12H7Cl3FN3 and a molecular weight of 318.57 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[(3-fluorophenyl)methylideneamino]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[(3-fluorophenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 4000923 |
| Molecular Formula | C12H7Cl3FN3 |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | 3,5,6-trichloro-N-[(3-fluorophenyl)methylideneamino]pyridin-2-amine |
| SMILES | Fc1cccc(C=NNc2nc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C12H7Cl3FN3/c13-9-5-10(14)12(18-11(9)15)19-17-6-7-2-1-3-8(16)4-7/h1-6H,(H,18,19) |
| InChIKey | DOXCJLSHIUXVFT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|