C29H28N2O5S — CID 4001095
2-[2-[4-(4-tert-butylphenoxy)-3-nitrophenyl]ethenyl]-4-(3,4-dimethoxyphenyl)-1,3-thiazole (PubChem CID 4001095) has the molecular formula C29H28N2O5S and a molecular weight of 516.62 g/mol. Its IUPAC name is 2-[2-[4-(4-tert-butylphenoxy)-3-nitrophenyl]ethenyl]-4-(3,4-dimethoxyphenyl)-1,3-thiazole.
| Compound Name | 2-[2-[4-(4-tert-butylphenoxy)-3-nitrophenyl]ethenyl]-4-(3,4-dimethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 4001095 |
| Molecular Formula | C29H28N2O5S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 2-[2-[4-(4-tert-butylphenoxy)-3-nitrophenyl]ethenyl]-4-(3,4-dimethoxyphenyl)-1,3-thiazole |
| SMILES | COc1ccc(-c2csc(C=Cc3ccc(Oc4ccc(C(C)(C)C)cc4)c([N+](=O)[O-])c3)n2)cc1OC |
| InChI | InChI=1S/C29H28N2O5S/c1-29(2,3)21-9-11-22(12-10-21)36-25-13-6-19(16-24(25)31(32)33)7-15-28-30-23(18-37-28)20-8-14-26(34-4)27(17-20)35-5/h6-18H,1-5H3 |
| InChIKey | AUAXSHWAHJDDOS-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|