C14H10Cl3NOS — CID 4001438
2-(2-chlorophenyl)sulfanyl-N-(2,3-dichlorophenyl)acetamide (PubChem CID 4001438) has the molecular formula C14H10Cl3NOS and a molecular weight of 346.67 g/mol. Its IUPAC name is 2-(2-chlorophenyl)sulfanyl-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-(2-chlorophenyl)sulfanyl-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4001438 |
| Molecular Formula | C14H10Cl3NOS |
| Molecular Weight | 346.67 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | 2-(2-chlorophenyl)sulfanyl-N-(2,3-dichlorophenyl)acetamide |
| SMILES | O=C(CSc1ccccc1Cl)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H10Cl3NOS/c15-9-4-1-2-7-12(9)20-8-13(19)18-11-6-3-5-10(16)14(11)17/h1-7H,8H2,(H,18,19) |
| InChIKey | HDQVSEFUKHCMJD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |