C19H21N3O3S — CID 4001786
methyl 3-[2-[(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylidene]hydrazinyl]thiophene-2-carboxylate (PubChem CID 4001786) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is methyl 3-[2-[(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylidene]hydrazinyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[2-[(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylidene]hydrazinyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4001786 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | methyl 3-[2-[(6-hydroxy-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-7-yl)methylidene]hydrazinyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NN=Cc1cc2c3c(c1O)CCCN3CCC2 |
| InChI | InChI=1S/C19H21N3O3S/c1-25-19(24)18-15(6-9-26-18)21-20-11-13-10-12-4-2-7-22-8-3-5-14(16(12)22)17(13)23/h6,9-11,21,23H,2-5,7-8H2,1H3 |
| InChIKey | KTYSHFYZHYEUAY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|