C22H27F3N2O3 — CID 4001842
2,2,2-trifluoroethyl 2-[2-(2,5-dimethyl-1H-indol-3-yl)ethylcarbamoyl]cyclohexane-1-carboxylate (PubChem CID 4001842) has the molecular formula C22H27F3N2O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[2-(2,5-dimethyl-1H-indol-3-yl)ethylcarbamoyl]cyclohexane-1-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl 2-[2-(2,5-dimethyl-1H-indol-3-yl)ethylcarbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 4001842 |
| Molecular Formula | C22H27F3N2O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[2-(2,5-dimethyl-1H-indol-3-yl)ethylcarbamoyl]cyclohexane-1-carboxylate |
| SMILES | Cc1ccc2[nH]c(C)c(CCNC(=O)C3CCCCC3C(=O)OCC(F)(F)F)c2c1 |
| InChI | InChI=1S/C22H27F3N2O3/c1-13-7-8-19-18(11-13)15(14(2)27-19)9-10-26-20(28)16-5-3-4-6-17(16)21(29)30-12-22(23,24)25/h7-8,11,16-17,27H,3-6,9-10,12H2,1-2H3,(H,26,28) |
| InChIKey | OHOKVVUGDQTARO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|