C25H29N3O4S — CID 4001896
N-(4-acetylphenyl)-2-[2-(4-ethylphenyl)imino-3-(1-methoxypropan-2-yl)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 4001896) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[2-(4-ethylphenyl)imino-3-(1-methoxypropan-2-yl)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[2-(4-ethylphenyl)imino-3-(1-methoxypropan-2-yl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 4001896 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-(4-acetylphenyl)-2-[2-(4-ethylphenyl)imino-3-(1-methoxypropan-2-yl)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CCc1ccc(/N=C2\SC(CC(=O)Nc3ccc(C(C)=O)cc3)C(=O)N2C(C)COC)cc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-5-18-6-10-21(11-7-18)27-25-28(16(2)15-32-4)24(31)22(33-25)14-23(30)26-20-12-8-19(9-13-20)17(3)29/h6-13,16,22H,5,14-15H2,1-4H3,(H,26,30)/b27-25- |
| InChIKey | SSYNFTUUACNDLQ-RFBIWTDZSA-N |
| XLogP | 4.45 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|