C27H29N3O6S — CID 4002271
2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-N-phenylacetamide (PubChem CID 4002271) has the molecular formula C27H29N3O6S and a molecular weight of 523.61 g/mol. Its IUPAC name is 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 4002271 |
| Molecular Formula | C27H29N3O6S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 2-[4-[[3-[2-(azepan-1-yl)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]-N-phenylacetamide |
| SMILES | COc1cc(C=C2SC(=O)N(CC(=O)N3CCCCCC3)C2=O)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H29N3O6S/c1-35-22-15-19(11-12-21(22)36-18-24(31)28-20-9-5-4-6-10-20)16-23-26(33)30(27(34)37-23)17-25(32)29-13-7-2-3-8-14-29/h4-6,9-12,15-16H,2-3,7-8,13-14,17-18H2,1H3,(H,28,31) |
| InChIKey | BFPKOOPQFQHZJQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|