C16H15Cl2N3S — CID 4002488
2,5-bis(4-chlorophenyl)-5-ethyl-1,2,4-triazolidine-3-thione (PubChem CID 4002488) has the molecular formula C16H15Cl2N3S and a molecular weight of 352.29 g/mol. Its IUPAC name is 2,5-bis(4-chlorophenyl)-5-ethyl-1,2,4-triazolidine-3-thione.
| Compound Name | 2,5-bis(4-chlorophenyl)-5-ethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 4002488 |
| Molecular Formula | C16H15Cl2N3S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 2,5-bis(4-chlorophenyl)-5-ethyl-1,2,4-triazolidine-3-thione |
| SMILES | CCC1(c2ccc(Cl)cc2)NC(=S)N(c2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C16H15Cl2N3S/c1-2-16(11-3-5-12(17)6-4-11)19-15(22)21(20-16)14-9-7-13(18)8-10-14/h3-10,20H,2H2,1H3,(H,19,22) |
| InChIKey | YPHABXJTGXFUIR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|