C16H18N6 — CID 4004860
N-butyl-4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 4004860) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is N-butyl-4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 4004860 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-butyl-4-imidazol-1-yl-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | CCCCNc1nc(-c2ccccc2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C16H18N6/c1-2-3-9-18-15-19-14(13-7-5-4-6-8-13)20-16(21-15)22-11-10-17-12-22/h4-8,10-12H,2-3,9H2,1H3,(H,18,19,20,21) |
| InChIKey | AQWGAONOHAWRKJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|