C17H24N4O2S2 — CID 4005131
[2-[(7,7-dimethyl-5-oxo-6,8-dihydroquinazolin-2-yl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 4005131) has the molecular formula C17H24N4O2S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is [2-[(7,7-dimethyl-5-oxo-6,8-dihydroquinazolin-2-yl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[(7,7-dimethyl-5-oxo-6,8-dihydroquinazolin-2-yl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 4005131 |
| Molecular Formula | C17H24N4O2S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | [2-[(7,7-dimethyl-5-oxo-6,8-dihydroquinazolin-2-yl)amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)Nc1ncc2c(n1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C17H24N4O2S2/c1-5-21(6-2)16(24)25-10-14(23)20-15-18-9-11-12(19-15)7-17(3,4)8-13(11)22/h9H,5-8,10H2,1-4H3,(H,18,19,20,23) |
| InChIKey | DXJUFYQMJSBUDO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|