C24H23N3O2 — CID 4005704
4-(4-methoxyphenyl)-3,5,7-trimethyl-11-(5-methylfuran-2-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene (PubChem CID 4005704) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-3,5,7-trimethyl-11-(5-methylfuran-2-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene.
| Compound Name | 4-(4-methoxyphenyl)-3,5,7-trimethyl-11-(5-methylfuran-2-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
|---|---|
| PubChem CID | 4005704 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-(4-methoxyphenyl)-3,5,7-trimethyl-11-(5-methylfuran-2-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
| SMILES | COc1ccc(-n2c(C)c3c(C)nn4cc(-c5ccc(C)o5)cc4c3c2C)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-14-6-11-22(29-14)18-12-21-24-17(4)27(19-7-9-20(28-5)10-8-19)16(3)23(24)15(2)25-26(21)13-18/h6-13H,1-5H3 |
| InChIKey | BZBIBBRGOIWNTO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 44.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |