C23H15Cl2F3N4 — CID 4005864
10,12-dichloro-4-methyl-2-phenyl-6-[3-(trifluoromethyl)phenyl]-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene (PubChem CID 4005864) has the molecular formula C23H15Cl2F3N4 and a molecular weight of 475.30 g/mol. Its IUPAC name is 10,12-dichloro-4-methyl-2-phenyl-6-[3-(trifluoromethyl)phenyl]-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene.
| Compound Name | 10,12-dichloro-4-methyl-2-phenyl-6-[3-(trifluoromethyl)phenyl]-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
|---|---|
| PubChem CID | 4005864 |
| Molecular Formula | C23H15Cl2F3N4 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 10,12-dichloro-4-methyl-2-phenyl-6-[3-(trifluoromethyl)phenyl]-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
| SMILES | Cc1nn(-c2cccc(C(F)(F)F)c2)c2c1C(c1ccccc1)N1C=C(Cl)C=C(Cl)C1=N2 |
| InChI | InChI=1S/C23H15Cl2F3N4/c1-13-19-20(14-6-3-2-4-7-14)31-12-16(24)11-18(25)21(31)29-22(19)32(30-13)17-9-5-8-15(10-17)23(26,27)28/h2-12,20H,1H3 |
| InChIKey | RNCMEERANLVRFB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |