C20H16F3N3O4 — CID 4006231
[1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 4006231) has the molecular formula C20H16F3N3O4 and a molecular weight of 419.36 g/mol. Its IUPAC name is [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-methyl-4-oxophthalazine-1-carboxylate.
| Compound Name | [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-methyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 4006231 |
| Molecular Formula | C20H16F3N3O4 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | CC(OC(=O)c1nn(C)c(=O)c2ccccc12)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F3N3O4/c1-11(17(27)24-13-7-5-6-12(10-13)20(21,22)23)30-19(29)16-14-8-3-4-9-15(14)18(28)26(2)25-16/h3-11H,1-2H3,(H,24,27) |
| InChIKey | BXIKKFYSTXZFSS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |