About 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol
5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol (PubChem CID 4007391) has the molecular formula C17H13N3O3
and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol.
Molecular Properties
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol |
| PubChem CID | 4007391 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol |
| SMILES | Oc1ccc(/N=N/c2ccc3c(c2)OCCO3)c2cccnc12 |
| InChI | InChI=1S/C17H13N3O3/c21-14-5-4-13(12-2-1-7-18-17(12)14)20-19-11-3-6-15-16(10-11)23-9-8-22-15/h1-7,10,21H,8-9H2/b20-19+ |
| InChIKey | XDRNYKAWKXMSIB-FMQUCBEESA-N |
| XLogP | 4.13 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol?
The IUPAC name of 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol (CID 4007391) is 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol.
What is the SMILES notation for 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol?
The canonical SMILES for 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol is Oc1ccc(/N=N/c2ccc3c(c2)OCCO3)c2cccnc12.
What is the InChIKey of 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol?
The InChIKey is XDRNYKAWKXMSIB-FMQUCBEESA-N. The full InChI is InChI=1S/C17H13N3O3/c21-14-5-4-13(12-2-1-7-18-17(12)14)20-19-11-3-6-15-16(10-11)23-9-8-22-15/h1-7,10,21H,8-9H2/b20-19+.
What are the key properties of 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol?
5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol has a molecular weight of 307.31 g/mol, XLogP of 4.13, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydro-1,4-benzodioxin-6-yldiazenyl)quinolin-8-ol is sourced from PubChem (CID 4007391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).