C22H18ClN5OS — CID 4009100
N-(2-chloro-3-pyridinyl)-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 4009100) has the molecular formula C22H18ClN5OS and a molecular weight of 435.94 g/mol. Its IUPAC name is N-(2-chloro-3-pyridinyl)-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-chloro-3-pyridinyl)-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 4009100 |
| Molecular Formula | C22H18ClN5OS |
| Molecular Weight | 435.94 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-(2-chloro-3-pyridinyl)-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3cccnc3Cl)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H18ClN5OS/c1-15-9-11-17(12-10-15)28-21(16-6-3-2-4-7-16)26-27-22(28)30-14-19(29)25-18-8-5-13-24-20(18)23/h2-13H,14H2,1H3,(H,25,29) |
| InChIKey | OESPYZPDJPCSDY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.94 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|