C8H17N3S — CID 4009641
5-butyl-2,5-dimethyl-1,2,4-triazolidine-3-thione (PubChem CID 4009641) has the molecular formula C8H17N3S and a molecular weight of 187.31 g/mol. Its IUPAC name is 5-butyl-2,5-dimethyl-1,2,4-triazolidine-3-thione.
| Compound Name | 5-butyl-2,5-dimethyl-1,2,4-triazolidine-3-thione |
|---|---|
| PubChem CID | 4009641 |
| Molecular Formula | C8H17N3S |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 5-butyl-2,5-dimethyl-1,2,4-triazolidine-3-thione |
| SMILES | CCCCC1(C)NC(=S)N(C)N1 |
| InChI | InChI=1S/C8H17N3S/c1-4-5-6-8(2)9-7(12)11(3)10-8/h10H,4-6H2,1-3H3,(H,9,12) |
| InChIKey | XCVIFALFCYZEFY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|