C23H27FN2O7 — CID 4010124
3-O,5-O-diethyl 4-O-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 4010124) has the molecular formula C23H27FN2O7 and a molecular weight of 462.47 g/mol. Its IUPAC name is 3-O,5-O-diethyl 4-O-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 3-O,5-O-diethyl 4-O-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 4010124 |
| Molecular Formula | C23H27FN2O7 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 3-O,5-O-diethyl 4-O-[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(=O)OCC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H27FN2O7/c1-5-31-21(28)18-13(3)26-14(4)19(22(29)32-6-2)20(18)23(30)33-12-17(27)25-11-15-7-9-16(24)10-8-15/h7-10,20,26H,5-6,11-12H2,1-4H3,(H,25,27) |
| InChIKey | PZYRNOBHCDTBDQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|