C27H33N3O5S — CID 4012122
4-[hydroxy-[2-(4-methylphenyl)-4,5-dioxo-1-(2-piperidin-1-ylethyl)pyrrolidin-3-ylidene]methyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 4012122) has the molecular formula C27H33N3O5S and a molecular weight of 511.64 g/mol. Its IUPAC name is 4-[hydroxy-[2-(4-methylphenyl)-4,5-dioxo-1-(2-piperidin-1-ylethyl)pyrrolidin-3-ylidene]methyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[hydroxy-[2-(4-methylphenyl)-4,5-dioxo-1-(2-piperidin-1-ylethyl)pyrrolidin-3-ylidene]methyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4012122 |
| Molecular Formula | C27H33N3O5S |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | 4-[hydroxy-[2-(4-methylphenyl)-4,5-dioxo-1-(2-piperidin-1-ylethyl)pyrrolidin-3-ylidene]methyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C2C(=C(O)c3ccc(S(=O)(=O)N(C)C)cc3)C(=O)C(=O)N2CCN2CCCCC2)cc1 |
| InChI | InChI=1S/C27H33N3O5S/c1-19-7-9-20(10-8-19)24-23(25(31)21-11-13-22(14-12-21)36(34,35)28(2)3)26(32)27(33)30(24)18-17-29-15-5-4-6-16-29/h7-14,24,31H,4-6,15-18H2,1-3H3 |
| InChIKey | QCAWVMVPYWZRGL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|