C19H15N3O2S2 — CID 4013372
2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-(3-methoxyphenyl)acetamide (PubChem CID 4013372) has the molecular formula C19H15N3O2S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4013372 |
| Molecular Formula | C19H15N3O2S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 2-[(3-cyano-6-thiophen-2-yl-2-pyridinyl)sulfanyl]-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(NC(=O)CSc2nc(-c3cccs3)ccc2C#N)c1 |
| InChI | InChI=1S/C19H15N3O2S2/c1-24-15-5-2-4-14(10-15)21-18(23)12-26-19-13(11-20)7-8-16(22-19)17-6-3-9-25-17/h2-10H,12H2,1H3,(H,21,23) |
| InChIKey | FMPHJGWYPWHNHZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |