About 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide
1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide (PubChem CID 4013727) has the molecular formula C19H13N3O5S2
and a molecular weight of 427.46 g/mol. Its IUPAC name is 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide.
Molecular Properties
| Compound Name | 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide |
| PubChem CID | 4013727 |
| Molecular Formula | C19H13N3O5S2 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1cc2ccccc2c(=O)o1 |
| InChI | InChI=1S/C19H13N3O5S2/c23-17(16-11-12-3-1-2-4-15(12)18(24)27-16)21-13-5-7-14(8-6-13)29(25,26)22-19-20-9-10-28-19/h1-11H,(H,20,22)(H,21,23) |
| InChIKey | LLAYOHLUUVFDHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide?
The IUPAC name of 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide (CID 4013727) is 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide.
What is the SMILES notation for 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide?
The canonical SMILES for 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide is O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1cc2ccccc2c(=O)o1.
What is the InChIKey of 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide?
The InChIKey is LLAYOHLUUVFDHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N3O5S2/c23-17(16-11-12-3-1-2-4-15(12)18(24)27-16)21-13-5-7-14(8-6-13)29(25,26)22-19-20-9-10-28-19/h1-11H,(H,20,22)(H,21,23).
What are the key properties of 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide?
1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide has a molecular weight of 427.46 g/mol, XLogP of 3.30, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxo-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]isochromene-3-carboxamide is sourced from PubChem (CID 4013727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).