C19H26N6OS2 — CID 4014018
[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 3,5-dimethylpiperidine-1-carbodithioate (PubChem CID 4014018) has the molecular formula C19H26N6OS2 and a molecular weight of 418.59 g/mol. Its IUPAC name is [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 3,5-dimethylpiperidine-1-carbodithioate.
| Compound Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 3,5-dimethylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 4014018 |
| Molecular Formula | C19H26N6OS2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 3,5-dimethylpiperidine-1-carbodithioate |
| SMILES | COc1ccccc1Nc1nc(N)nc(CSC(=S)N2CC(C)CC(C)C2)n1 |
| InChI | InChI=1S/C19H26N6OS2/c1-12-8-13(2)10-25(9-12)19(27)28-11-16-22-17(20)24-18(23-16)21-14-6-4-5-7-15(14)26-3/h4-7,12-13H,8-11H2,1-3H3,(H3,20,21,22,23,24) |
| InChIKey | YGMKXVKSOHULFY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|