C23H21ClN2O4 — CID 4014221
2-chloro-N-[2-methoxy-4-[[2-(4-methylphenoxy)acetyl]amino]phenyl]benzamide (PubChem CID 4014221) has the molecular formula C23H21ClN2O4 and a molecular weight of 424.88 g/mol. Its IUPAC name is 2-chloro-N-[2-methoxy-4-[[2-(4-methylphenoxy)acetyl]amino]phenyl]benzamide.
| Compound Name | 2-chloro-N-[2-methoxy-4-[[2-(4-methylphenoxy)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 4014221 |
| Molecular Formula | C23H21ClN2O4 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-chloro-N-[2-methoxy-4-[[2-(4-methylphenoxy)acetyl]amino]phenyl]benzamide |
| SMILES | COc1cc(NC(=O)COc2ccc(C)cc2)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C23H21ClN2O4/c1-15-7-10-17(11-8-15)30-14-22(27)25-16-9-12-20(21(13-16)29-2)26-23(28)18-5-3-4-6-19(18)24/h3-13H,14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | IVRBKOIURSMGLE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |