About bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+)
bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+) (PubChem CID 4014505) has the molecular formula C24H20Br2MnN6O2+2
and a molecular weight of 639.21 g/mol. Its IUPAC name is bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+).
Molecular Properties
| Compound Name | bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+) |
| PubChem CID | 4014505 |
| Molecular Formula | C24H20Br2MnN6O2+2 |
| Molecular Weight | 639.21 g/mol |
| Exact Mass | 636.94 |
| IUPAC Name | bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+) |
| SMILES | [Mn+2].[OH2+]c1cc(Br)ccc1C=N[N-]c1ccccn1.[OH2+]c1cc(Br)ccc1C=N[N-]c1ccccn1 |
| InChI | InChI=1S/2C12H9BrN3O.Mn/c2*13-10-5-4-9(11(17)7-10)8-15-16-12-3-1-2-6-14-12;/h2*1-8H,(H-,14,15,16,17);/q2*-1;+2/p+2 |
| InChIKey | XQAANWIKIHTTCM-UHFFFAOYSA-P |
| XLogP | 6.64 |
| TPSA | 124.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 639.21 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+)?
The IUPAC name of bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+) (CID 4014505) is bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+).
What is the SMILES notation for bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+)?
The canonical SMILES for bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+) is [Mn+2].[OH2+]c1cc(Br)ccc1C=N[N-]c1ccccn1.[OH2+]c1cc(Br)ccc1C=N[N-]c1ccccn1.
What is the InChIKey of bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+)?
The InChIKey is XQAANWIKIHTTCM-UHFFFAOYSA-P. The full InChI is InChI=1S/2C12H9BrN3O.Mn/c2*13-10-5-4-9(11(17)7-10)8-15-16-12-3-1-2-6-14-12;/h2*1-8H,(H-,14,15,16,17);/q2*-1;+2/p+2.
What are the key properties of bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+)?
bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+) has a molecular weight of 639.21 g/mol, XLogP of 6.64, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis([(4-bromo-2-oxoniophenyl)methylideneamino]-pyridin-2-ylazanide);manganese(2+) is sourced from PubChem (CID 4014505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).