C23H23FN2O3 — CID 4017113
methyl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxo-1-prop-2-enylpyrrole-3-carboxylate (PubChem CID 4017113) has the molecular formula C23H23FN2O3 and a molecular weight of 394.45 g/mol. Its IUPAC name is methyl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxo-1-prop-2-enylpyrrole-3-carboxylate.
| Compound Name | methyl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxo-1-prop-2-enylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4017113 |
| Molecular Formula | C23H23FN2O3 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | methyl 4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-methyl-5-oxo-1-prop-2-enylpyrrole-3-carboxylate |
| SMILES | C=CCN1C(=O)C(=Cc2cc(C)n(-c3ccc(F)cc3)c2C)C(C(=O)OC)=C1C |
| InChI | InChI=1S/C23H23FN2O3/c1-6-11-25-16(4)21(23(28)29-5)20(22(25)27)13-17-12-14(2)26(15(17)3)19-9-7-18(24)8-10-19/h6-10,12-13H,1,11H2,2-5H3 |
| InChIKey | AHZNXGHBKQZCRI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|