About 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 4017430) has the molecular formula C21H23N3O3
and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide.
Molecular Properties
| Compound Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide |
| PubChem CID | 4017430 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)NCc2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C21H23N3O3/c1-3-21(17-7-5-4-6-8-17)19(26)24(20(27)23-21)14-18(25)22-13-16-11-9-15(2)10-12-16/h4-12H,3,13-14H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | FAFCFDWMWRXWHD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide?
The IUPAC name of 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide (CID 4017430) is 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide.
What is the SMILES notation for 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide?
The canonical SMILES for 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide is CCC1(c2ccccc2)NC(=O)N(CC(=O)NCc2ccc(C)cc2)C1=O.
What is the InChIKey of 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide?
The InChIKey is FAFCFDWMWRXWHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O3/c1-3-21(17-7-5-4-6-8-17)19(26)24(20(27)23-21)14-18(25)22-13-16-11-9-15(2)10-12-16/h4-12H,3,13-14H2,1-2H3,(H,22,25)(H,23,27).
What are the key properties of 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide?
2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide has a molecular weight of 365.43 g/mol, XLogP of 2.47, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)-N-[(4-methylphenyl)methyl]acetamide is sourced from PubChem (CID 4017430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).