C26H27N3O5 — CID 4018200
4-[[5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]furan-2-yl]methyl]-7-methyl-1,4-benzoxazin-3-one (PubChem CID 4018200) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 4-[[5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]furan-2-yl]methyl]-7-methyl-1,4-benzoxazin-3-one.
| Compound Name | 4-[[5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]furan-2-yl]methyl]-7-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 4018200 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 4-[[5-[4-(4-methoxyphenyl)piperazine-1-carbonyl]furan-2-yl]methyl]-7-methyl-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(CN4C(=O)COc5cc(C)ccc54)o3)CC2)cc1 |
| InChI | InChI=1S/C26H27N3O5/c1-18-3-9-22-24(15-18)33-17-25(30)29(22)16-21-8-10-23(34-21)26(31)28-13-11-27(12-14-28)19-4-6-20(32-2)7-5-19/h3-10,15H,11-14,16-17H2,1-2H3 |
| InChIKey | QVJLJLZQYSKXCV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|