C17H14N4O — CID 4018347
2-amino-4-(furan-2-yl)-5,6,7,8-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile (PubChem CID 4018347) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-amino-4-(furan-2-yl)-5,6,7,8-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile.
| Compound Name | 2-amino-4-(furan-2-yl)-5,6,7,8-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 4018347 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-amino-4-(furan-2-yl)-5,6,7,8-tetrahydro-4H-naphthalene-1,3,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C(c2ccco2)C2=C1CCCC2 |
| InChI | InChI=1S/C17H14N4O/c18-8-13-11-4-1-2-5-12(11)15(14-6-3-7-22-14)17(9-19,10-20)16(13)21/h3,6-7,15H,1-2,4-5,21H2 |
| InChIKey | HAQXRHVWHNQNLP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|