About 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol
4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol (PubChem CID 4019011) has the molecular formula C20H20FN5OS
and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol.
Molecular Properties
| Compound Name | 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol |
| PubChem CID | 4019011 |
| Molecular Formula | C20H20FN5OS |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol |
| SMILES | OC1(c2ccccc2F)CS/C(=N\c2cccnc2)N1CCCn1ccnc1 |
| InChI | InChI=1S/C20H20FN5OS/c21-18-7-2-1-6-17(18)20(27)14-28-19(24-16-5-3-8-22-13-16)26(20)11-4-10-25-12-9-23-15-25/h1-3,5-9,12-13,15,27H,4,10-11,14H2/b24-19- |
| InChIKey | FDVGSKSEGWLXPE-CLCOLTQESA-N |
| XLogP | 3.39 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The IUPAC name of 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol (CID 4019011) is 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol.
What is the SMILES notation for 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The canonical SMILES for 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol is OC1(c2ccccc2F)CS/C(=N\c2cccnc2)N1CCCn1ccnc1.
What is the InChIKey of 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
The InChIKey is FDVGSKSEGWLXPE-CLCOLTQESA-N. The full InChI is InChI=1S/C20H20FN5OS/c21-18-7-2-1-6-17(18)20(27)14-28-19(24-16-5-3-8-22-13-16)26(20)11-4-10-25-12-9-23-15-25/h1-3,5-9,12-13,15,27H,4,10-11,14H2/b24-19-.
What are the key properties of 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol?
4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol has a molecular weight of 397.48 g/mol, XLogP of 3.39, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluorophenyl)-3-(3-imidazol-1-ylpropyl)-2-pyridin-3-ylimino-1,3-thiazolidin-4-ol is sourced from PubChem (CID 4019011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).