C14H11N3O2S — CID 4019395
2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide (PubChem CID 4019395) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | 2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4019395 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-[(5-naphthalen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetamide |
| SMILES | NC(=O)CSc1nnc(-c2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C14H11N3O2S/c15-12(18)8-20-14-17-16-13(19-14)11-6-5-9-3-1-2-4-10(9)7-11/h1-7H,8H2,(H2,15,18) |
| InChIKey | QVRNCBJWGKCHGE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |