C22H26FN3O3 — CID 4019456
N-(2-fluorophenyl)-N'-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylideneamino]butanediamide (PubChem CID 4019456) has the molecular formula C22H26FN3O3 and a molecular weight of 399.47 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylideneamino]butanediamide.
| Compound Name | N-(2-fluorophenyl)-N'-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 4019456 |
| Molecular Formula | C22H26FN3O3 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | N-(2-fluorophenyl)-N'-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methylideneamino]butanediamide |
| SMILES | COc1cc(C)c(C=NNC(=O)CCC(=O)Nc2ccccc2F)cc1C(C)C |
| InChI | InChI=1S/C22H26FN3O3/c1-14(2)17-12-16(15(3)11-20(17)29-4)13-24-26-22(28)10-9-21(27)25-19-8-6-5-7-18(19)23/h5-8,11-14H,9-10H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | OWKUZRGEOSHHHZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|