About bis(8-hydroxyquinoline-5-sulfonic acid);zinc
bis(8-hydroxyquinoline-5-sulfonic acid);zinc (PubChem CID 4019772) has the molecular formula C18H14N2O8S2Zn
and a molecular weight of 515.84 g/mol. Its IUPAC name is bis(8-hydroxyquinoline-5-sulfonic acid);zinc.
Molecular Properties
| Compound Name | bis(8-hydroxyquinoline-5-sulfonic acid);zinc |
| PubChem CID | 4019772 |
| Molecular Formula | C18H14N2O8S2Zn |
| Molecular Weight | 515.84 g/mol |
| Exact Mass | 513.95 |
| IUPAC Name | bis(8-hydroxyquinoline-5-sulfonic acid);zinc |
| SMILES | O=S(=O)(O)c1ccc(O)c2ncccc12.O=S(=O)(O)c1ccc(O)c2ncccc12.[Zn] |
| InChI | InChI=1S/2C9H7NO4S.Zn/c2*11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7;/h2*1-5,11H,(H,12,13,14); |
| InChIKey | RQTRQRSIOSXXRO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 515.84 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(8-hydroxyquinoline-5-sulfonic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(8-hydroxyquinoline-5-sulfonic acid);zinc?
The IUPAC name of bis(8-hydroxyquinoline-5-sulfonic acid);zinc (CID 4019772) is bis(8-hydroxyquinoline-5-sulfonic acid);zinc.
What is the SMILES notation for bis(8-hydroxyquinoline-5-sulfonic acid);zinc?
The canonical SMILES for bis(8-hydroxyquinoline-5-sulfonic acid);zinc is O=S(=O)(O)c1ccc(O)c2ncccc12.O=S(=O)(O)c1ccc(O)c2ncccc12.[Zn].
What is the InChIKey of bis(8-hydroxyquinoline-5-sulfonic acid);zinc?
The InChIKey is RQTRQRSIOSXXRO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7NO4S.Zn/c2*11-7-3-4-8(15(12,13)14)6-2-1-5-10-9(6)7;/h2*1-5,11H,(H,12,13,14);.
What are the key properties of bis(8-hydroxyquinoline-5-sulfonic acid);zinc?
bis(8-hydroxyquinoline-5-sulfonic acid);zinc has a molecular weight of 515.84 g/mol, XLogP of 2.37, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(8-hydroxyquinoline-5-sulfonic acid);zinc is sourced from PubChem (CID 4019772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).