C10H11ClN4S — CID 4020721
N'-(7-chloro-5-methyl-2,1,3-benzothiadiazol-4-yl)-N,N-dimethylmethanimidamide (PubChem CID 4020721) has the molecular formula C10H11ClN4S and a molecular weight of 254.75 g/mol. Its IUPAC name is N'-(7-chloro-5-methyl-2,1,3-benzothiadiazol-4-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(7-chloro-5-methyl-2,1,3-benzothiadiazol-4-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 4020721 |
| Molecular Formula | C10H11ClN4S |
| Molecular Weight | 254.75 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | N'-(7-chloro-5-methyl-2,1,3-benzothiadiazol-4-yl)-N,N-dimethylmethanimidamide |
| SMILES | Cc1cc(Cl)c2nsnc2c1/N=C/N(C)C |
| InChI | InChI=1S/C10H11ClN4S/c1-6-4-7(11)9-10(14-16-13-9)8(6)12-5-15(2)3/h4-5H,1-3H3/b12-5+ |
| InChIKey | JHCWJOQYJGCFMD-LFYBBSHMSA-N |
| XLogP | 2.87 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|