About 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole
2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole (PubChem CID 4020982) has the molecular formula C28H22N2S3
and a molecular weight of 482.70 g/mol. Its IUPAC name is 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole |
| PubChem CID | 4020982 |
| Molecular Formula | C28H22N2S3 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole |
| SMILES | c1ccc(C(Sc2nnc(SC(c3ccccc3)c3ccccc3)s2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22N2S3/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)31-27-29-30-28(33-27)32-26(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-26H |
| InChIKey | HKUYFQKQDXBMJN-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole?
The IUPAC name of 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole (CID 4020982) is 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole?
The canonical SMILES for 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole is c1ccc(C(Sc2nnc(SC(c3ccccc3)c3ccccc3)s2)c2ccccc2)cc1.
What is the InChIKey of 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole?
The InChIKey is HKUYFQKQDXBMJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H22N2S3/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22)31-27-29-30-28(33-27)32-26(23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20,25-26H.
What are the key properties of 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole?
2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole has a molecular weight of 482.70 g/mol, XLogP of 8.30, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(benzhydrylsulfanyl)-1,3,4-thiadiazole is sourced from PubChem (CID 4020982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).