C13H14BrNO4 — CID 4021425
5-bromo-6-methoxy-8-(2-nitroprop-1-enyl)-3,4-dihydro-2H-chromene (PubChem CID 4021425) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 5-bromo-6-methoxy-8-(2-nitroprop-1-enyl)-3,4-dihydro-2H-chromene.
| Compound Name | 5-bromo-6-methoxy-8-(2-nitroprop-1-enyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 4021425 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 5-bromo-6-methoxy-8-(2-nitroprop-1-enyl)-3,4-dihydro-2H-chromene |
| SMILES | COc1cc(C=C(C)[N+](=O)[O-])c2c(c1Br)CCCO2 |
| InChI | InChI=1S/C13H14BrNO4/c1-8(15(16)17)6-9-7-11(18-2)12(14)10-4-3-5-19-13(9)10/h6-7H,3-5H2,1-2H3 |
| InChIKey | NKKPESGNULRHQJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|