C23H19NO2S — CID 4022131
[4-(4-cyanophenyl)phenyl] 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 4022131) has the molecular formula C23H19NO2S and a molecular weight of 373.48 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4022131 |
| Molecular Formula | C23H19NO2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | CC1CCc2sc(C(=O)Oc3ccc(-c4ccc(C#N)cc4)cc3)cc2C1 |
| InChI | InChI=1S/C23H19NO2S/c1-15-2-11-21-19(12-15)13-22(27-21)23(25)26-20-9-7-18(8-10-20)17-5-3-16(14-24)4-6-17/h3-10,13,15H,2,11-12H2,1H3 |
| InChIKey | DWGZJAOWARXEMM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|