C20H26N4O7S — CID 4022475
[2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 4022475) has the molecular formula C20H26N4O7S and a molecular weight of 466.52 g/mol. Its IUPAC name is [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 4022475 |
| Molecular Formula | C20H26N4O7S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [2-[3-(dimethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CN2C(=O)NC3(CCCC3)C2=O)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C20H26N4O7S/c1-13-6-7-14(10-15(13)32(29,30)23(2)3)21-16(25)12-31-17(26)11-24-18(27)20(22-19(24)28)8-4-5-9-20/h6-7,10H,4-5,8-9,11-12H2,1-3H3,(H,21,25)(H,22,28) |
| InChIKey | NAFUKUCUDHZSLJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|