6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid

C14H17NO8 — CID 4022661

IUPAC6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid
SMILESCC(=O)Nc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1
InChIInChI=1S/C14H17NO8/c1-6(16)15-7-2-4-8(5-3-7)22-14-11(19)9(17)10(18)12(23-14)13(20)21/h2-5,9-12,14,17-19H,1H3,(H,15,16)(H,20,21)
InChIKeyIPROLSVTVHAQLE-UHFFFAOYSA-N
MW327.29 g/mol
LogP-1.08
Rot. Bonds4

About 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid

6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 4022661) has the molecular formula C14H17NO8 and a molecular weight of 327.29 g/mol. Its IUPAC name is 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.

Molecular Properties

Compound Name6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid
PubChem CID4022661
Molecular FormulaC14H17NO8
Molecular Weight327.29 g/mol
Exact Mass327.10
IUPAC Name6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid
SMILESCC(=O)Nc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1
InChIInChI=1S/C14H17NO8/c1-6(16)15-7-2-4-8(5-3-7)22-14-11(19)9(17)10(18)12(23-14)13(20)21/h2-5,9-12,14,17-19H,1H3,(H,15,16)(H,20,21)
InChIKeyIPROLSVTVHAQLE-UHFFFAOYSA-N
XLogP-1.08
TPSA145.55 Ų
H-Bond Donors5
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500327.29
LogP ≤ 5-1.08
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 107

Analyze 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid?
The IUPAC name of 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (CID 4022661) is 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
What is the SMILES notation for 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid?
The canonical SMILES for 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid is CC(=O)Nc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1.
What is the InChIKey of 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid?
The InChIKey is IPROLSVTVHAQLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO8/c1-6(16)15-7-2-4-8(5-3-7)22-14-11(19)9(17)10(18)12(23-14)13(20)21/h2-5,9-12,14,17-19H,1H3,(H,15,16)(H,20,21).
What are the key properties of 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid?
6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid has a molecular weight of 327.29 g/mol, XLogP of -1.08, 4 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid is sourced from PubChem (CID 4022661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).