C14H17NO8 — CID 4022661
6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 4022661) has the molecular formula C14H17NO8 and a molecular weight of 327.29 g/mol. Its IUPAC name is 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 4022661 |
| Molecular Formula | C14H17NO8 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC(=O)Nc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C14H17NO8/c1-6(16)15-7-2-4-8(5-3-7)22-14-11(19)9(17)10(18)12(23-14)13(20)21/h2-5,9-12,14,17-19H,1H3,(H,15,16)(H,20,21) |
| InChIKey | IPROLSVTVHAQLE-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |