C26H32N2O2S2 — CID 4024448
3-(3-methylbutyl)-2-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 4024448) has the molecular formula C26H32N2O2S2 and a molecular weight of 468.69 g/mol. Its IUPAC name is 3-(3-methylbutyl)-2-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-(3-methylbutyl)-2-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4024448 |
| Molecular Formula | C26H32N2O2S2 |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 3-(3-methylbutyl)-2-[2-oxo-2-(2,4,5-trimethylphenyl)ethyl]sulfanyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc(C)c(C(=O)CSc2nc3sc4c(c3c(=O)n2CCC(C)C)CCCC4)cc1C |
| InChI | InChI=1S/C26H32N2O2S2/c1-15(2)10-11-28-25(30)23-19-8-6-7-9-22(19)32-24(23)27-26(28)31-14-21(29)20-13-17(4)16(3)12-18(20)5/h12-13,15H,6-11,14H2,1-5H3 |
| InChIKey | SGYGUAAQIAIWBV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |