C21H22FN3O3S2 — CID 4024830
3-[[3-[3-(4-fluorophenyl)prop-2-enoyl]-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide (PubChem CID 4024830) has the molecular formula C21H22FN3O3S2 and a molecular weight of 447.56 g/mol. Its IUPAC name is 3-[[3-[3-(4-fluorophenyl)prop-2-enoyl]-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[3-[3-(4-fluorophenyl)prop-2-enoyl]-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4024830 |
| Molecular Formula | C21H22FN3O3S2 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 3-[[3-[3-(4-fluorophenyl)prop-2-enoyl]-5-methyl-1,3-thiazolidin-2-ylidene]amino]-N,N-dimethylbenzenesulfonamide |
| SMILES | CC1CN(C(=O)C=Cc2ccc(F)cc2)/C(=N/c2cccc(S(=O)(=O)N(C)C)c2)S1 |
| InChI | InChI=1S/C21H22FN3O3S2/c1-15-14-25(20(26)12-9-16-7-10-17(22)11-8-16)21(29-15)23-18-5-4-6-19(13-18)30(27,28)24(2)3/h4-13,15H,14H2,1-3H3/b12-9?,23-21- |
| InChIKey | WYKHVMXJEOKGBX-JVPSZMRZSA-N |
| XLogP | 3.74 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|