C29H19Br2N3O3S2 — CID 4024845
1-[3',3'-bis(4-bromophenyl)-4-(4-nitrophenyl)spiro[1,3,4-thiadiazole-5,1'-2-benzothiophene]-2-yl]ethanone (PubChem CID 4024845) has the molecular formula C29H19Br2N3O3S2 and a molecular weight of 681.43 g/mol. Its IUPAC name is 1-[3',3'-bis(4-bromophenyl)-4-(4-nitrophenyl)spiro[1,3,4-thiadiazole-5,1'-2-benzothiophene]-2-yl]ethanone.
| Compound Name | 1-[3',3'-bis(4-bromophenyl)-4-(4-nitrophenyl)spiro[1,3,4-thiadiazole-5,1'-2-benzothiophene]-2-yl]ethanone |
|---|---|
| PubChem CID | 4024845 |
| Molecular Formula | C29H19Br2N3O3S2 |
| Molecular Weight | 681.43 g/mol |
| Exact Mass | 678.92 |
| IUPAC Name | 1-[3',3'-bis(4-bromophenyl)-4-(4-nitrophenyl)spiro[1,3,4-thiadiazole-5,1'-2-benzothiophene]-2-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccc([N+](=O)[O-])cc2)C2(S1)SC(c1ccc(Br)cc1)(c1ccc(Br)cc1)c1ccccc12 |
| InChI | InChI=1S/C29H19Br2N3O3S2/c1-18(35)27-32-33(23-14-16-24(17-15-23)34(36)37)29(38-27)26-5-3-2-4-25(26)28(39-29,19-6-10-21(30)11-7-19)20-8-12-22(31)13-9-20/h2-17H,1H3 |
| InChIKey | NINWTFVGAXOBQD-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.43 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|