About 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol
4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol (PubChem CID 4025252) has the molecular formula C9H9N5O
and a molecular weight of 203.21 g/mol. Its IUPAC name is 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol.
Molecular Properties
| Compound Name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol |
| PubChem CID | 4025252 |
| Molecular Formula | C9H9N5O |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol |
| SMILES | Cc1nc(/N=N/c2ccc(O)cc2)n[nH]1 |
| InChI | InChI=1S/C9H9N5O/c1-6-10-9(13-11-6)14-12-7-2-4-8(15)5-3-7/h2-5,15H,1H3,(H,10,11,13)/b14-12+ |
| InChIKey | ZEUCMUNWWGISSI-WYMLVPIESA-N |
| XLogP | 2.23 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol?
The IUPAC name of 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol (CID 4025252) is 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol.
What is the SMILES notation for 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol?
The canonical SMILES for 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol is Cc1nc(/N=N/c2ccc(O)cc2)n[nH]1.
What is the InChIKey of 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol?
The InChIKey is ZEUCMUNWWGISSI-WYMLVPIESA-N. The full InChI is InChI=1S/C9H9N5O/c1-6-10-9(13-11-6)14-12-7-2-4-8(15)5-3-7/h2-5,15H,1H3,(H,10,11,13)/b14-12+.
What are the key properties of 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol?
4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol has a molecular weight of 203.21 g/mol, XLogP of 2.23, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-methyl-1H-1,2,4-triazol-3-yl)diazenyl]phenol is sourced from PubChem (CID 4025252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).